C25H21F2N5O4S — CID 170376471
2-[(2,6-difluorophenyl)methylamino]-4-ethyl-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide (PubChem CID 170376471) has the molecular formula C25H21F2N5O4S and a molecular weight of 525.54 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methylamino]-4-ethyl-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide.
| Compound Name | 2-[(2,6-difluorophenyl)methylamino]-4-ethyl-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 170376471 |
| Molecular Formula | C25H21F2N5O4S |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methylamino]-4-ethyl-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide |
| SMILES | CCc1c(-c2ccc([N+](=O)[O-])cc2)sc(NCc2c(F)cccc2F)c1C(=O)Nc1ccc(OC)nn1 |
| InChI | InChI=1S/C25H21F2N5O4S/c1-3-16-22(24(33)29-20-11-12-21(36-2)31-30-20)25(28-13-17-18(26)5-4-6-19(17)27)37-23(16)14-7-9-15(10-8-14)32(34)35/h4-12,28H,3,13H2,1-2H3,(H,29,30,33) |
| InChIKey | HEVCESXFPRZISZ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|