C26H24F2N6O4S — CID 170371084
2-[(2,6-difluorophenyl)methylamino]-4-[(dimethylamino)methyl]-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide (PubChem CID 170371084) has the molecular formula C26H24F2N6O4S and a molecular weight of 554.58 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methylamino]-4-[(dimethylamino)methyl]-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide.
| Compound Name | 2-[(2,6-difluorophenyl)methylamino]-4-[(dimethylamino)methyl]-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 170371084 |
| Molecular Formula | C26H24F2N6O4S |
| Molecular Weight | 554.58 g/mol |
| Exact Mass | 554.15 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methylamino]-4-[(dimethylamino)methyl]-N-(6-methoxypyridazin-3-yl)-5-(4-nitrophenyl)thiophene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(NCc3c(F)cccc3F)sc(-c3ccc([N+](=O)[O-])cc3)c2CN(C)C)nn1 |
| InChI | InChI=1S/C26H24F2N6O4S/c1-33(2)14-18-23(25(35)30-21-11-12-22(38-3)32-31-21)26(29-13-17-19(27)5-4-6-20(17)28)39-24(18)15-7-9-16(10-8-15)34(36)37/h4-12,29H,13-14H2,1-3H3,(H,30,31,35) |
| InChIKey | JUUSITGNNVYJEP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.58 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|