C22H20F3N5O6S — CID 175182463
[4-[(dimethylamino)methyl]-5-(4-nitrophenyl)-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamoyl]thiophen-2-yl] carbamate (PubChem CID 175182463) has the molecular formula C22H20F3N5O6S and a molecular weight of 539.49 g/mol. Its IUPAC name is [4-[(dimethylamino)methyl]-5-(4-nitrophenyl)-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamoyl]thiophen-2-yl] carbamate.
| Compound Name | [4-[(dimethylamino)methyl]-5-(4-nitrophenyl)-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamoyl]thiophen-2-yl] carbamate |
|---|---|
| PubChem CID | 175182463 |
| Molecular Formula | C22H20F3N5O6S |
| Molecular Weight | 539.49 g/mol |
| Exact Mass | 539.11 |
| IUPAC Name | [4-[(dimethylamino)methyl]-5-(4-nitrophenyl)-3-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamoyl]thiophen-2-yl] carbamate |
| SMILES | CN(C)Cc1c(-c2ccc([N+](=O)[O-])cc2)sc(OC(N)=O)c1C(=O)Nc1ccc(OCC(F)(F)F)nc1 |
| InChI | InChI=1S/C22H20F3N5O6S/c1-29(2)10-15-17(19(31)28-13-5-8-16(27-9-13)35-11-22(23,24)25)20(36-21(26)32)37-18(15)12-3-6-14(7-4-12)30(33)34/h3-9H,10-11H2,1-2H3,(H2,26,32)(H,28,31) |
| InChIKey | SJWKENMNBUMWFR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|