C26H30N2O8 — CID 170379046
(3-methylphenyl)methyl (2S)-5-(1,3-dioxoisoindol-2-yl)oxy-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 170379046) has the molecular formula C26H30N2O8 and a molecular weight of 498.53 g/mol. Its IUPAC name is (3-methylphenyl)methyl (2S)-5-(1,3-dioxoisoindol-2-yl)oxy-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | (3-methylphenyl)methyl (2S)-5-(1,3-dioxoisoindol-2-yl)oxy-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 170379046 |
| Molecular Formula | C26H30N2O8 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | (3-methylphenyl)methyl (2S)-5-(1,3-dioxoisoindol-2-yl)oxy-5-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | Cc1cccc(COC(=O)[C@H](CCC(O)ON2C(=O)c3ccccc3C2=O)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H30N2O8/c1-16-8-7-9-17(14-16)15-34-24(32)20(27-25(33)35-26(2,3)4)12-13-21(29)36-28-22(30)18-10-5-6-11-19(18)23(28)31/h5-11,14,20-21,29H,12-13,15H2,1-4H3,(H,27,33)/t20-,21?/m0/s1 |
| InChIKey | NDUSEQHRKDTPRU-BGERDNNASA-N |
| XLogP | 3.26 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|