About 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide
2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide (PubChem CID 170391446) has the molecular formula C10H22N2O2S
and a molecular weight of 234.36 g/mol. Its IUPAC name is 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide.
Molecular Properties
| Compound Name | 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide |
| PubChem CID | 170391446 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide |
| SMILES | CCCCC(CC)C(=O)N=S(C)(=O)NC |
| InChI | InChI=1S/C10H22N2O2S/c1-5-7-8-9(6-2)10(13)12-15(4,14)11-3/h9H,5-8H2,1-4H3,(H,11,12,13,14) |
| InChIKey | OEYWYSOMHUOVQF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide?
The IUPAC name of 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide (CID 170391446) is 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide.
What is the SMILES notation for 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide?
The canonical SMILES for 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide is CCCCC(CC)C(=O)N=S(C)(=O)NC.
What is the InChIKey of 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide?
The InChIKey is OEYWYSOMHUOVQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2S/c1-5-7-8-9(6-2)10(13)12-15(4,14)11-3/h9H,5-8H2,1-4H3,(H,11,12,13,14).
What are the key properties of 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide?
2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide has a molecular weight of 234.36 g/mol, XLogP of 1.96, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-[methyl-(methylamino)-oxo-λ6-sulfanylidene]hexanamide is sourced from PubChem (CID 170391446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).