C23H28F2N2O4 — CID 170395838
(2R,3S,4S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-(1-hydroxy-2-methoxyethyl)-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide (PubChem CID 170395838) has the molecular formula C23H28F2N2O4 and a molecular weight of 434.48 g/mol. Its IUPAC name is (2R,3S,4S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-(1-hydroxy-2-methoxyethyl)-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,4S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-(1-hydroxy-2-methoxyethyl)-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 170395838 |
| Molecular Formula | C23H28F2N2O4 |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (2R,3S,4S)-3-(3,4-difluoro-2-methylphenyl)-N-[6-(1-hydroxy-2-methoxyethyl)-3-pyridinyl]-4,5,5-trimethyloxolane-2-carboxamide |
| SMILES | COCC(O)c1ccc(NC(=O)[C@@H]2OC(C)(C)[C@@H](C)[C@H]2c2ccc(F)c(F)c2C)cn1 |
| InChI | InChI=1S/C23H28F2N2O4/c1-12-15(7-8-16(24)20(12)25)19-13(2)23(3,4)31-21(19)22(29)27-14-6-9-17(26-10-14)18(28)11-30-5/h6-10,13,18-19,21,28H,11H2,1-5H3,(H,27,29)/t13-,18?,19-,21+/m0/s1 |
| InChIKey | GEUQPYCLCFYLLB-JYKJZDRQSA-N |
| XLogP | 3.88 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |