C26H21N3O2 — CID 170439312
3-(7-hex-1-ynyl-2,4-dioxo-1H-benzo[g][1,5]benzodiazepin-5-yl)benzonitrile (PubChem CID 170439312) has the molecular formula C26H21N3O2 and a molecular weight of 407.47 g/mol. Its IUPAC name is 3-(7-hex-1-ynyl-2,4-dioxo-1H-benzo[g][1,5]benzodiazepin-5-yl)benzonitrile.
| Compound Name | 3-(7-hex-1-ynyl-2,4-dioxo-1H-benzo[g][1,5]benzodiazepin-5-yl)benzonitrile |
|---|---|
| PubChem CID | 170439312 |
| Molecular Formula | C26H21N3O2 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 3-(7-hex-1-ynyl-2,4-dioxo-1H-benzo[g][1,5]benzodiazepin-5-yl)benzonitrile |
| SMILES | CCCCC#Cc1cc2c(c3ccccc13)NC(=O)CC(=O)N2c1cccc(C#N)c1 |
| InChI | InChI=1S/C26H21N3O2/c1-2-3-4-5-10-19-15-23-26(22-13-7-6-12-21(19)22)28-24(30)16-25(31)29(23)20-11-8-9-18(14-20)17-27/h6-9,11-15H,2-4,16H2,1H3,(H,28,30) |
| InChIKey | YHBHYUIVKJUBME-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|