C13H8ClFN4O — CID 170450675
[1-[(2-chloropyrimidin-5-yl)amino]isoquinolin-6-yl] hypofluorite (PubChem CID 170450675) has the molecular formula C13H8ClFN4O and a molecular weight of 290.69 g/mol. Its IUPAC name is [1-[(2-chloropyrimidin-5-yl)amino]isoquinolin-6-yl] hypofluorite.
| Compound Name | [1-[(2-chloropyrimidin-5-yl)amino]isoquinolin-6-yl] hypofluorite |
|---|---|
| PubChem CID | 170450675 |
| Molecular Formula | C13H8ClFN4O |
| Molecular Weight | 290.69 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | [1-[(2-chloropyrimidin-5-yl)amino]isoquinolin-6-yl] hypofluorite |
| SMILES | FOc1ccc2c(Nc3cnc(Cl)nc3)nccc2c1 |
| InChI | InChI=1S/C13H8ClFN4O/c14-13-17-6-9(7-18-13)19-12-11-2-1-10(20-15)5-8(11)3-4-16-12/h1-7H,(H,16,19) |
| InChIKey | ZJPQWYYZMDHXFL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.69 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |