C21H18N2 — CID 170459366
6,9-diazapentacyclo[9.8.2.214,17.02,10.03,8]tricosa-1,3(8),4,6,10,14,16,20,22-nonaene (PubChem CID 170459366) has the molecular formula C21H18N2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 6,9-diazapentacyclo[9.8.2.214,17.02,10.03,8]tricosa-1,3(8),4,6,10,14,16,20,22-nonaene.
| Compound Name | 6,9-diazapentacyclo[9.8.2.214,17.02,10.03,8]tricosa-1,3(8),4,6,10,14,16,20,22-nonaene |
|---|---|
| PubChem CID | 170459366 |
| Molecular Formula | C21H18N2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 6,9-diazapentacyclo[9.8.2.214,17.02,10.03,8]tricosa-1,3(8),4,6,10,14,16,20,22-nonaene |
| SMILES | c1cc2c(cn1)[nH]c1c3ccc(c12)CCc1ccc(cc1)CC3 |
| InChI | InChI=1S/C21H18N2/c1-3-15-4-2-14(1)5-7-16-9-10-17(8-6-15)21-20(16)18-11-12-22-13-19(18)23-21/h1-4,9-13,23H,5-8H2 |
| InChIKey | CMWOXPAPYBMMJQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |