C21H18N2O3S — CID 170463350
benzyl N-[4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-ynyl]carbamate (PubChem CID 170463350) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is benzyl N-[4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-ynyl]carbamate.
| Compound Name | benzyl N-[4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-ynyl]carbamate |
|---|---|
| PubChem CID | 170463350 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | benzyl N-[4-[4-(2-oxo-3H-1,3-thiazol-4-yl)phenyl]but-3-ynyl]carbamate |
| SMILES | O=C(NCCC#Cc1ccc(-c2csc(=O)[nH]2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H18N2O3S/c24-20(26-14-17-7-2-1-3-8-17)22-13-5-4-6-16-9-11-18(12-10-16)19-15-27-21(25)23-19/h1-3,7-12,15H,5,13-14H2,(H,22,24)(H,23,25) |
| InChIKey | KOLPSJWFCLGGAU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|