C24H28N2O4 — CID 90162908
(2S)-2-(dimethylamino)-4-[4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]phenyl]butanoic acid (PubChem CID 90162908) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (2S)-2-(dimethylamino)-4-[4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]phenyl]butanoic acid.
| Compound Name | (2S)-2-(dimethylamino)-4-[4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 90162908 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (2S)-2-(dimethylamino)-4-[4-[4-(phenylmethoxycarbonylamino)but-1-ynyl]phenyl]butanoic acid |
| SMILES | CN(C)[C@@H](CCc1ccc(C#CCCNC(=O)OCc2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C24H28N2O4/c1-26(2)22(23(27)28)16-15-20-13-11-19(12-14-20)8-6-7-17-25-24(29)30-18-21-9-4-3-5-10-21/h3-5,9-14,22H,7,15-18H2,1-2H3,(H,25,29)(H,27,28)/t22-/m0/s1 |
| InChIKey | BLCRWXNARZQQKE-QFIPXVFZSA-N |
| XLogP | 3.30 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|