C9H10N2O4 — CID 170500556
methyl 4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enoate (PubChem CID 170500556) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is methyl 4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enoate.
| Compound Name | methyl 4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enoate |
|---|---|
| PubChem CID | 170500556 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | methyl 4-(4-hydroxy-6-oxo-1H-pyrimidin-5-yl)but-3-enoate |
| SMILES | COC(=O)CC=Cc1c(O)nc[nH]c1=O |
| InChI | InChI=1S/C9H10N2O4/c1-15-7(12)4-2-3-6-8(13)10-5-11-9(6)14/h2-3,5H,4H2,1H3,(H2,10,11,13,14) |
| InChIKey | QOGJREXDYXLTHJ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |