C16H13N3O3 — CID 170522400
3-(6-methyl-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-2-yl)piperidine-2,6-dione (PubChem CID 170522400) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 3-(6-methyl-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(6-methyl-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 170522400 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 3-(6-methyl-3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(12),4,6,8,10-pentaen-2-yl)piperidine-2,6-dione |
| SMILES | Cc1cc2c3c(cncc3c1)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C16H13N3O3/c1-8-4-9-6-17-7-12-14(9)10(5-8)16(22)19(12)11-2-3-13(20)18-15(11)21/h4-7,11H,2-3H2,1H3,(H,18,20,21) |
| InChIKey | NCELTOMDUSEXQV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|