About 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione
1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione (PubChem CID 170533519) has the molecular formula C9H13ClN2O3
and a molecular weight of 232.67 g/mol. Its IUPAC name is 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione.
Molecular Properties
| Compound Name | 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione |
| PubChem CID | 170533519 |
| Molecular Formula | C9H13ClN2O3 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC(C)CN1C(=O)CC(=O)N(Cl)C1=O |
| InChI | InChI=1S/C9H13ClN2O3/c1-3-6(2)5-11-7(13)4-8(14)12(10)9(11)15/h6H,3-5H2,1-2H3 |
| InChIKey | FJBICJDUSZSQDN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione?
The IUPAC name of 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione (CID 170533519) is 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione.
What is the SMILES notation for 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione?
The canonical SMILES for 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione is CCC(C)CN1C(=O)CC(=O)N(Cl)C1=O.
What is the InChIKey of 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione?
The InChIKey is FJBICJDUSZSQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13ClN2O3/c1-3-6(2)5-11-7(13)4-8(14)12(10)9(11)15/h6H,3-5H2,1-2H3.
What are the key properties of 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione?
1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione has a molecular weight of 232.67 g/mol, XLogP of 1.37, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(2-methylbutyl)-1,3-diazinane-2,4,6-trione is sourced from PubChem (CID 170533519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).