C14H26N2O2Si — CID 170550593
[1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methanol (PubChem CID 170550593) has the molecular formula C14H26N2O2Si and a molecular weight of 282.46 g/mol. Its IUPAC name is [1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methanol.
| Compound Name | [1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methanol |
|---|---|
| PubChem CID | 170550593 |
| Molecular Formula | C14H26N2O2Si |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | [1-(2-trimethylsilylethoxymethyl)-4,5,6,7-tetrahydroindazol-4-yl]methanol |
| SMILES | C[Si](C)(C)CCOCn1ncc2c1CCCC2CO |
| InChI | InChI=1S/C14H26N2O2Si/c1-19(2,3)8-7-18-11-16-14-6-4-5-12(10-17)13(14)9-15-16/h9,12,17H,4-8,10-11H2,1-3H3 |
| InChIKey | GOIBTSXCPGSTRX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|