About N-(2-iodophenyl)-N,2-dimethoxybenzamide
N-(2-iodophenyl)-N,2-dimethoxybenzamide (PubChem CID 170552313) has the molecular formula C15H14INO3
and a molecular weight of 383.19 g/mol. Its IUPAC name is N-(2-iodophenyl)-N,2-dimethoxybenzamide.
Molecular Properties
| Compound Name | N-(2-iodophenyl)-N,2-dimethoxybenzamide |
| PubChem CID | 170552313 |
| Molecular Formula | C15H14INO3 |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 383.00 |
| IUPAC Name | N-(2-iodophenyl)-N,2-dimethoxybenzamide |
| SMILES | COc1ccccc1C(=O)N(OC)c1ccccc1I |
| InChI | InChI=1S/C15H14INO3/c1-19-14-10-6-3-7-11(14)15(18)17(20-2)13-9-5-4-8-12(13)16/h3-10H,1-2H3 |
| InChIKey | HWXHUNAWICRZDT-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-iodophenyl)-N,2-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-iodophenyl)-N,2-dimethoxybenzamide?
The IUPAC name of N-(2-iodophenyl)-N,2-dimethoxybenzamide (CID 170552313) is N-(2-iodophenyl)-N,2-dimethoxybenzamide.
What is the SMILES notation for N-(2-iodophenyl)-N,2-dimethoxybenzamide?
The canonical SMILES for N-(2-iodophenyl)-N,2-dimethoxybenzamide is COc1ccccc1C(=O)N(OC)c1ccccc1I.
What is the InChIKey of N-(2-iodophenyl)-N,2-dimethoxybenzamide?
The InChIKey is HWXHUNAWICRZDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14INO3/c1-19-14-10-6-3-7-11(14)15(18)17(20-2)13-9-5-4-8-12(13)16/h3-10H,1-2H3.
What are the key properties of N-(2-iodophenyl)-N,2-dimethoxybenzamide?
N-(2-iodophenyl)-N,2-dimethoxybenzamide has a molecular weight of 383.19 g/mol, XLogP of 3.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-iodophenyl)-N,2-dimethoxybenzamide is sourced from PubChem (CID 170552313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).