C22H33BFN3O4S — CID 170556435
N-ethyl-N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethanesulfonamide (PubChem CID 170556435) has the molecular formula C22H33BFN3O4S and a molecular weight of 465.40 g/mol. Its IUPAC name is N-ethyl-N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethanesulfonamide.
| Compound Name | N-ethyl-N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 170556435 |
| Molecular Formula | C22H33BFN3O4S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N-ethyl-N-[4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(1,3,5-trimethylpyrazol-4-yl)phenyl]ethanesulfonamide |
| SMILES | CCN(c1cc(B2OC(C)(C)C(C)(C)O2)c(F)c(-c2c(C)nn(C)c2C)c1)S(=O)(=O)CC |
| InChI | InChI=1S/C22H33BFN3O4S/c1-10-27(32(28,29)11-2)16-12-17(19-14(3)25-26(9)15(19)4)20(24)18(13-16)23-30-21(5,6)22(7,8)31-23/h12-13H,10-11H2,1-9H3 |
| InChIKey | VMZVYSYYVMRTIQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|