About triethylphosphane;trihydrofluoride
triethylphosphane;trihydrofluoride (PubChem CID 170563479) has the molecular formula C6H18F3P
and a molecular weight of 178.18 g/mol. Its IUPAC name is triethylphosphane;trihydrofluoride.
Molecular Properties
| Compound Name | triethylphosphane;trihydrofluoride |
| PubChem CID | 170563479 |
| Molecular Formula | C6H18F3P |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | triethylphosphane;trihydrofluoride |
| SMILES | CCP(CC)CC.F.F.F |
| InChI | InChI=1S/C6H15P.3FH/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;3*1H |
| InChIKey | BIASCTJGSCZEIY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triethylphosphane;trihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethylphosphane;trihydrofluoride?
The IUPAC name of triethylphosphane;trihydrofluoride (CID 170563479) is triethylphosphane;trihydrofluoride.
What is the SMILES notation for triethylphosphane;trihydrofluoride?
The canonical SMILES for triethylphosphane;trihydrofluoride is CCP(CC)CC.F.F.F.
What is the InChIKey of triethylphosphane;trihydrofluoride?
The InChIKey is BIASCTJGSCZEIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P.3FH/c1-4-7(5-2)6-3;;;/h4-6H2,1-3H3;3*1H.
What are the key properties of triethylphosphane;trihydrofluoride?
triethylphosphane;trihydrofluoride has a molecular weight of 178.18 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylphosphane;trihydrofluoride is sourced from PubChem (CID 170563479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).