About tribromogold;triethylphosphane
tribromogold;triethylphosphane (PubChem CID 57348370) has the molecular formula C6H15AuBr3P
and a molecular weight of 554.84 g/mol. Its IUPAC name is tribromogold;triethylphosphane.
Molecular Properties
| Compound Name | tribromogold;triethylphosphane |
| PubChem CID | 57348370 |
| Molecular Formula | C6H15AuBr3P |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 551.81 |
| IUPAC Name | tribromogold;triethylphosphane |
| SMILES | Br[Au](Br)Br.CCP(CC)CC |
| InChI | InChI=1S/C6H15P.Au.3BrH/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | JELHWNHHIOMFRD-UHFFFAOYSA-K |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tribromogold;triethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribromogold;triethylphosphane?
The IUPAC name of tribromogold;triethylphosphane (CID 57348370) is tribromogold;triethylphosphane.
What is the SMILES notation for tribromogold;triethylphosphane?
The canonical SMILES for tribromogold;triethylphosphane is Br[Au](Br)Br.CCP(CC)CC.
What is the InChIKey of tribromogold;triethylphosphane?
The InChIKey is JELHWNHHIOMFRD-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H15P.Au.3BrH/c1-4-7(5-2)6-3;;;;/h4-6H2,1-3H3;;3*1H/q;+3;;;/p-3.
What are the key properties of tribromogold;triethylphosphane?
tribromogold;triethylphosphane has a molecular weight of 554.84 g/mol, XLogP of 5.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tribromogold;triethylphosphane is sourced from PubChem (CID 57348370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).