About chloroplatinum;bis(triethylphosphane)
chloroplatinum;bis(triethylphosphane) (PubChem CID 85447619) has the molecular formula C12H30ClP2Pt
and a molecular weight of 466.85 g/mol. Its IUPAC name is chloroplatinum;bis(triethylphosphane).
Molecular Properties
| Compound Name | chloroplatinum;bis(triethylphosphane) |
| PubChem CID | 85447619 |
| Molecular Formula | C12H30ClP2Pt |
| Molecular Weight | 466.85 g/mol |
| Exact Mass | 466.12 |
| IUPAC Name | chloroplatinum;bis(triethylphosphane) |
| SMILES | CCP(CC)CC.CCP(CC)CC.Cl[Pt] |
| InChI | InChI=1S/2C6H15P.ClH.Pt/c2*1-4-7(5-2)6-3;;/h2*4-6H2,1-3H3;1H;/q;;;+1/p-1 |
| InChIKey | DDISOJWETDMUSY-UHFFFAOYSA-M |
| XLogP | 5.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.85 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloroplatinum;bis(triethylphosphane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroplatinum;bis(triethylphosphane)?
The IUPAC name of chloroplatinum;bis(triethylphosphane) (CID 85447619) is chloroplatinum;bis(triethylphosphane).
What is the SMILES notation for chloroplatinum;bis(triethylphosphane)?
The canonical SMILES for chloroplatinum;bis(triethylphosphane) is CCP(CC)CC.CCP(CC)CC.Cl[Pt].
What is the InChIKey of chloroplatinum;bis(triethylphosphane)?
The InChIKey is DDISOJWETDMUSY-UHFFFAOYSA-M. The full InChI is InChI=1S/2C6H15P.ClH.Pt/c2*1-4-7(5-2)6-3;;/h2*4-6H2,1-3H3;1H;/q;;;+1/p-1.
What are the key properties of chloroplatinum;bis(triethylphosphane)?
chloroplatinum;bis(triethylphosphane) has a molecular weight of 466.85 g/mol, XLogP of 5.74, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloroplatinum;bis(triethylphosphane) is sourced from PubChem (CID 85447619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).