C25H34F2N4O4 — CID 170573176
tert-butyl N-[8-(4,4-difluoropiperidin-1-yl)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-methylquinolin-6-yl]carbamate (PubChem CID 170573176) has the molecular formula C25H34F2N4O4 and a molecular weight of 492.57 g/mol. Its IUPAC name is tert-butyl N-[8-(4,4-difluoropiperidin-1-yl)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-methylquinolin-6-yl]carbamate.
| Compound Name | tert-butyl N-[8-(4,4-difluoropiperidin-1-yl)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-methylquinolin-6-yl]carbamate |
|---|---|
| PubChem CID | 170573176 |
| Molecular Formula | C25H34F2N4O4 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | tert-butyl N-[8-(4,4-difluoropiperidin-1-yl)-2-[formyl-[(2-methylpropan-2-yl)oxy]amino]-3-methylquinolin-6-yl]carbamate |
| SMILES | Cc1cc2cc(NC(=O)OC(C)(C)C)cc(N3CCC(F)(F)CC3)c2nc1N(C=O)OC(C)(C)C |
| InChI | InChI=1S/C25H34F2N4O4/c1-16-12-17-13-18(28-22(33)34-23(2,3)4)14-19(30-10-8-25(26,27)9-11-30)20(17)29-21(16)31(15-32)35-24(5,6)7/h12-15H,8-11H2,1-7H3,(H,28,33) |
| InChIKey | INQJIXBZMIJMLZ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|