C6H9N5O — CID 170584758
6-amino-9-methyl-3,7-dihydro-2H-purin-8-one (PubChem CID 170584758) has the molecular formula C6H9N5O and a molecular weight of 167.17 g/mol. Its IUPAC name is 6-amino-9-methyl-3,7-dihydro-2H-purin-8-one.
| Compound Name | 6-amino-9-methyl-3,7-dihydro-2H-purin-8-one |
|---|---|
| PubChem CID | 170584758 |
| Molecular Formula | C6H9N5O |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 6-amino-9-methyl-3,7-dihydro-2H-purin-8-one |
| SMILES | Cn1c2c([nH]c1=O)C(N)=NCN2 |
| InChI | InChI=1S/C6H9N5O/c1-11-5-3(10-6(11)12)4(7)8-2-9-5/h9H,2H2,1H3,(H2,7,8)(H,10,12) |
| InChIKey | IIJXFQMBNCZPHC-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |