C17H17N5OS — CID 170592741
4-anilino-8-methoxy-1,7-naphthyridine-3-carbonitrile;N-methylthiohydroxylamine (PubChem CID 170592741) has the molecular formula C17H17N5OS and a molecular weight of 339.42 g/mol. Its IUPAC name is 4-anilino-8-methoxy-1,7-naphthyridine-3-carbonitrile;N-methylthiohydroxylamine.
| Compound Name | 4-anilino-8-methoxy-1,7-naphthyridine-3-carbonitrile;N-methylthiohydroxylamine |
|---|---|
| PubChem CID | 170592741 |
| Molecular Formula | C17H17N5OS |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-anilino-8-methoxy-1,7-naphthyridine-3-carbonitrile;N-methylthiohydroxylamine |
| SMILES | CNS.COc1nccc2c(Nc3ccccc3)c(C#N)cnc12 |
| InChI | InChI=1S/C16H12N4O.CH5NS/c1-21-16-15-13(7-8-18-16)14(11(9-17)10-19-15)20-12-5-3-2-4-6-12;1-2-3/h2-8,10H,1H3,(H,19,20);2-3H,1H3 |
| InChIKey | ASRZRZGHONXOIW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|