C20H29N5OS — CID 170592789
N',N'-dimethylethane-1,2-diamine;methanethiol;8-methoxy-N-phenyl-1,7-naphthyridin-4-amine (PubChem CID 170592789) has the molecular formula C20H29N5OS and a molecular weight of 387.55 g/mol. Its IUPAC name is N',N'-dimethylethane-1,2-diamine;methanethiol;8-methoxy-N-phenyl-1,7-naphthyridin-4-amine.
| Compound Name | N',N'-dimethylethane-1,2-diamine;methanethiol;8-methoxy-N-phenyl-1,7-naphthyridin-4-amine |
|---|---|
| PubChem CID | 170592789 |
| Molecular Formula | C20H29N5OS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N',N'-dimethylethane-1,2-diamine;methanethiol;8-methoxy-N-phenyl-1,7-naphthyridin-4-amine |
| SMILES | CN(C)CCN.COc1nccc2c(Nc3ccccc3)ccnc12.CS |
| InChI | InChI=1S/C15H13N3O.C4H12N2.CH4S/c1-19-15-14-12(7-9-17-15)13(8-10-16-14)18-11-5-3-2-4-6-11;1-6(2)4-3-5;1-2/h2-10H,1H3,(H,16,18);3-5H2,1-2H3;2H,1H3 |
| InChIKey | UHGUYPZTKDKAQS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|