About 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane
2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane (PubChem CID 170598866) has the molecular formula C19H38F2
and a molecular weight of 304.51 g/mol. Its IUPAC name is 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane.
Molecular Properties
| Compound Name | 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane |
| PubChem CID | 170598866 |
| Molecular Formula | C19H38F2 |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane |
| SMILES | CC(C)C(C)CCC(C)(F)F.CC(C)C1CCCCCC1 |
| InChI | InChI=1S/C10H20.C9H18F2/c1-9(2)10-7-5-3-4-6-8-10;1-7(2)8(3)5-6-9(4,10)11/h9-10H,3-8H2,1-2H3;7-8H,5-6H2,1-4H3 |
| InChIKey | JBFONRAEJVXHAL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane?
The IUPAC name of 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane (CID 170598866) is 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane.
What is the SMILES notation for 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane?
The canonical SMILES for 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane is CC(C)C(C)CCC(C)(F)F.CC(C)C1CCCCCC1.
What is the InChIKey of 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane?
The InChIKey is JBFONRAEJVXHAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20.C9H18F2/c1-9(2)10-7-5-3-4-6-8-10;1-7(2)8(3)5-6-9(4,10)11/h9-10H,3-8H2,1-2H3;7-8H,5-6H2,1-4H3.
What are the key properties of 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane?
2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane has a molecular weight of 304.51 g/mol, XLogP of 7.33, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane is sourced from PubChem (CID 170598866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).