C19H38F2 — CID 170598866
2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane (PubChem CID 170598866) has the molecular formula C19H38F2 and a molecular weight of 304.51 g/mol. Its IUPAC name is 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane.
| Compound Name | 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane |
|---|---|
| PubChem CID | 170598866 |
| Molecular Formula | C19H38F2 |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 2,2-difluoro-5,6-dimethylheptane;propan-2-ylcycloheptane |
| SMILES | CC(C)C(C)CCC(C)(F)F.CC(C)C1CCCCCC1 |
| InChI | InChI=1S/C10H20.C9H18F2/c1-9(2)10-7-5-3-4-6-8-10;1-7(2)8(3)5-6-9(4,10)11/h9-10H,3-8H2,1-2H3;7-8H,5-6H2,1-4H3 |
| InChIKey | JBFONRAEJVXHAL-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |