C11H17N3 — CID 170602766
3-diazenyl-N,N-dimethyl-1-phenylpropan-1-amine (PubChem CID 170602766) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-diazenyl-N,N-dimethyl-1-phenylpropan-1-amine.
| Compound Name | 3-diazenyl-N,N-dimethyl-1-phenylpropan-1-amine |
|---|---|
| PubChem CID | 170602766 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-diazenyl-N,N-dimethyl-1-phenylpropan-1-amine |
| SMILES | [H]/N=N/CCC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C11H17N3/c1-14(2)11(8-9-13-12)10-6-4-3-5-7-10/h3-7,11-12H,8-9H2,1-2H3/b13-12+ |
| InChIKey | QMHYVFPDHMBPEO-OUKQBFOZSA-N |
| XLogP | 2.71 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|