C21H37N — CID 170608726
N-[(2S,3S,7E,9Z)-3,8-dimethyl-7-propyldodeca-7,9,11-trien-2-yl]butan-2-imine (PubChem CID 170608726) has the molecular formula C21H37N and a molecular weight of 303.53 g/mol. Its IUPAC name is N-[(2S,3S,7E,9Z)-3,8-dimethyl-7-propyldodeca-7,9,11-trien-2-yl]butan-2-imine.
| Compound Name | N-[(2S,3S,7E,9Z)-3,8-dimethyl-7-propyldodeca-7,9,11-trien-2-yl]butan-2-imine |
|---|---|
| PubChem CID | 170608726 |
| Molecular Formula | C21H37N |
| Molecular Weight | 303.53 g/mol |
| Exact Mass | 303.29 |
| IUPAC Name | N-[(2S,3S,7E,9Z)-3,8-dimethyl-7-propyldodeca-7,9,11-trien-2-yl]butan-2-imine |
| SMILES | C=C/C=C\C(C)=C(/CCC)CCC[C@H](C)[C@H](C)/N=C(\C)CC |
| InChI | InChI=1S/C21H37N/c1-8-11-14-18(5)21(13-9-2)16-12-15-17(4)20(7)22-19(6)10-3/h8,11,14,17,20H,1,9-10,12-13,15-16H2,2-7H3/b14-11-,21-18+,22-19+/t17-,20-/m0/s1 |
| InChIKey | YAPDHYFRGWNUKO-DMXIJVDMSA-N |
| XLogP | 6.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.53 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|