C20H29Cl2N5O2Si- — CID 170610161
CID 170610161 (PubChem CID 170610161) has the molecular formula C20H29Cl2N5O2Si- and a molecular weight of 470.48 g/mol.
| Compound Name | CID 170610161 |
|---|---|
| PubChem CID | 170610161 |
| Molecular Formula | C20H29Cl2N5O2Si- |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si-](C)(C)OCCN(N)/C=C(\N)n1ccc2c(OCC#N)cc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C20H29Cl2N5O2Si/c1-20(2,3)30(4,5)29-11-9-26(25)13-17(24)27-8-6-14-16(28-10-7-23)12-15(21)18(22)19(14)27/h6,8,12-13H,9-11,24-25H2,1-5H3/q-1/b17-13+ |
| InChIKey | CCGPEKPHEDPOQN-GHRIWEEISA-N |
| XLogP | 4.76 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|