C12H16O — CID 170615832
2,3-bis(ethenyl)-4-methyl-5-propan-2-ylfuran (PubChem CID 170615832) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-4-methyl-5-propan-2-ylfuran.
| Compound Name | 2,3-bis(ethenyl)-4-methyl-5-propan-2-ylfuran |
|---|---|
| PubChem CID | 170615832 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2,3-bis(ethenyl)-4-methyl-5-propan-2-ylfuran |
| SMILES | C=Cc1oc(C(C)C)c(C)c1C=C |
| InChI | InChI=1S/C12H16O/c1-6-10-9(5)12(8(3)4)13-11(10)7-2/h6-8H,1-2H2,3-5H3 |
| InChIKey | IACLQQLCNXJNSW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |