C12H13F3 — CID 170636516
1-cyclopent-2-en-1-yl-6-(trifluoromethyl)cyclohexa-1,3-diene (PubChem CID 170636516) has the molecular formula C12H13F3 and a molecular weight of 214.23 g/mol. Its IUPAC name is 1-cyclopent-2-en-1-yl-6-(trifluoromethyl)cyclohexa-1,3-diene.
| Compound Name | 1-cyclopent-2-en-1-yl-6-(trifluoromethyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 170636516 |
| Molecular Formula | C12H13F3 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-cyclopent-2-en-1-yl-6-(trifluoromethyl)cyclohexa-1,3-diene |
| SMILES | FC(F)(F)C1CC=CC=C1C1C=CCC1 |
| InChI | InChI=1S/C12H13F3/c13-12(14,15)11-8-4-3-7-10(11)9-5-1-2-6-9/h1,3-5,7,9,11H,2,6,8H2 |
| InChIKey | DYWUGWOHHYLQJH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|