C25H28F2N6O — CID 170642499
N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-5-(3,4-dihydroquinolin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine (PubChem CID 170642499) has the molecular formula C25H28F2N6O and a molecular weight of 466.54 g/mol. Its IUPAC name is N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-5-(3,4-dihydroquinolin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine.
| Compound Name | N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-5-(3,4-dihydroquinolin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
|---|---|
| PubChem CID | 170642499 |
| Molecular Formula | C25H28F2N6O |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | N-[1-(3,3-difluorocyclobutyl)piperidin-4-yl]-5-(3,4-dihydroquinolin-6-yl)-4-methoxypyrrolo[2,1-f][1,2,4]triazin-2-amine |
| SMILES | COc1nc(NC2CCN(C3CC(F)(F)C3)CC2)nn2ccc(-c3ccc4c(c3)CCC=N4)c12 |
| InChI | InChI=1S/C25H28F2N6O/c1-34-23-22-20(16-4-5-21-17(13-16)3-2-9-28-21)8-12-33(22)31-24(30-23)29-18-6-10-32(11-7-18)19-14-25(26,27)15-19/h4-5,8-9,12-13,18-19H,2-3,6-7,10-11,14-15H2,1H3,(H,29,31) |
| InChIKey | ZOPWNKZBQYUURW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |