C28H42F3N3O2Si — CID 170656007
trimethyl-[2-[[3-[(2R)-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-3-yl]-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 170656007) has the molecular formula C28H42F3N3O2Si and a molecular weight of 537.74 g/mol. Its IUPAC name is trimethyl-[2-[[3-[(2R)-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-3-yl]-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-[(2R)-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-3-yl]-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 170656007 |
| Molecular Formula | C28H42F3N3O2Si |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | trimethyl-[2-[[3-[(2R)-2-[(4-phenylcyclohexyl)oxymethyl]piperidin-3-yl]-4-(trifluoromethyl)pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1cc(C(F)(F)F)c(C2CCCN[C@H]2COC2CCC(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C28H42F3N3O2Si/c1-37(2,3)17-16-35-20-34-18-25(28(29,30)31)27(33-34)24-10-7-15-32-26(24)19-36-23-13-11-22(12-14-23)21-8-5-4-6-9-21/h4-6,8-9,18,22-24,26,32H,7,10-17,19-20H2,1-3H3/t22?,23?,24?,26-/m0/s1 |
| InChIKey | ZALVBPTXHORPSI-WCINTBDISA-N |
| XLogP | 6.79 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|