C20H21N3O6S — CID 170666515
[(3R,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-5,10,13-trien-4-yl] methanesulfonate (PubChem CID 170666515) has the molecular formula C20H21N3O6S and a molecular weight of 431.47 g/mol. Its IUPAC name is [(3R,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-5,10,13-trien-4-yl] methanesulfonate.
| Compound Name | [(3R,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-5,10,13-trien-4-yl] methanesulfonate |
|---|---|
| PubChem CID | 170666515 |
| Molecular Formula | C20H21N3O6S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [(3R,7S)-11-methoxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-5,10,13-trien-4-yl] methanesulfonate |
| SMILES | COc1c2n(ccc1=O)N1[C@H](c3ccccc3)C(OS(C)(=O)=O)C=C[C@H]1N(C)C2=O |
| InChI | InChI=1S/C20H21N3O6S/c1-21-16-10-9-15(29-30(3,26)27)17(13-7-5-4-6-8-13)23(16)22-12-11-14(24)19(28-2)18(22)20(21)25/h4-12,15-17H,1-3H3/t15?,16-,17+/m0/s1 |
| InChIKey | IRPIFUDYKLNPES-LRUHZDSUSA-N |
| XLogP | 0.86 |
| TPSA | 98.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|