C27H27N3O4 — CID 162689057
(3R,4R,6E)-6-benzylidene-4-hydroxy-11-methoxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione (PubChem CID 162689057) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is (3R,4R,6E)-6-benzylidene-4-hydroxy-11-methoxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R,4R,6E)-6-benzylidene-4-hydroxy-11-methoxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 162689057 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (3R,4R,6E)-6-benzylidene-4-hydroxy-11-methoxy-3,8-dimethyl-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-9,12-dione |
| SMILES | COc1c2n(ccc1=O)N1C(/C(=C/c3ccccc3)C[C@@H](O)[C@@]1(C)c1ccccc1)N(C)C2=O |
| InChI | InChI=1S/C27H27N3O4/c1-27(20-12-8-5-9-13-20)22(32)17-19(16-18-10-6-4-7-11-18)25-28(2)26(33)23-24(34-3)21(31)14-15-29(23)30(25)27/h4-16,22,25,32H,17H2,1-3H3/b19-16+/t22-,25?,27-/m1/s1 |
| InChIKey | XGFNNODWQKTINQ-XCRAVTESSA-N |
| XLogP | 2.97 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |