C22H15ClF3N7O3 — CID 170676996
6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(1,2-oxazol-3-ylmethyl)-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione (PubChem CID 170676996) has the molecular formula C22H15ClF3N7O3 and a molecular weight of 517.86 g/mol. Its IUPAC name is 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(1,2-oxazol-3-ylmethyl)-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione.
| Compound Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(1,2-oxazol-3-ylmethyl)-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 170676996 |
| Molecular Formula | C22H15ClF3N7O3 |
| Molecular Weight | 517.86 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | 6-[(6-chloro-2-methylindazol-5-yl)amino]-3-(1,2-oxazol-3-ylmethyl)-1-[(2,4,5-trifluorophenyl)methyl]-1,3,5-triazine-2,4-dione |
| SMILES | Cn1cc2cc(Nc3nc(=O)n(Cc4ccon4)c(=O)n3Cc3cc(F)c(F)cc3F)c(Cl)cc2n1 |
| InChI | InChI=1S/C22H15ClF3N7O3/c1-31-8-12-5-19(14(23)6-18(12)29-31)27-20-28-21(34)33(10-13-2-3-36-30-13)22(35)32(20)9-11-4-16(25)17(26)7-15(11)24/h2-8H,9-10H2,1H3,(H,27,28,34) |
| InChIKey | UMTZWVLTDNCJJO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|