C15H10F3N3O — CID 170678047
4-phenyl-6-(trifluoromethylamino)-2H-2,7-naphthyridin-1-one (PubChem CID 170678047) has the molecular formula C15H10F3N3O and a molecular weight of 305.26 g/mol. Its IUPAC name is 4-phenyl-6-(trifluoromethylamino)-2H-2,7-naphthyridin-1-one.
| Compound Name | 4-phenyl-6-(trifluoromethylamino)-2H-2,7-naphthyridin-1-one |
|---|---|
| PubChem CID | 170678047 |
| Molecular Formula | C15H10F3N3O |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-phenyl-6-(trifluoromethylamino)-2H-2,7-naphthyridin-1-one |
| SMILES | O=c1[nH]cc(-c2ccccc2)c2cc(NC(F)(F)F)ncc12 |
| InChI | InChI=1S/C15H10F3N3O/c16-15(17,18)21-13-6-10-11(9-4-2-1-3-5-9)7-20-14(22)12(10)8-19-13/h1-8H,(H,19,21)(H,20,22) |
| InChIKey | GNFPVTSHVWXGTM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|