C17H14ClN9O2 — CID 170699244
5-chloro-2-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]-4-N-(1H-pyrazol-5-yl)pyrimidine-2,4-diamine (PubChem CID 170699244) has the molecular formula C17H14ClN9O2 and a molecular weight of 411.81 g/mol. Its IUPAC name is 5-chloro-2-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]-4-N-(1H-pyrazol-5-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]-4-N-(1H-pyrazol-5-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 170699244 |
| Molecular Formula | C17H14ClN9O2 |
| Molecular Weight | 411.81 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 5-chloro-2-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]-4-N-(1H-pyrazol-5-yl)pyrimidine-2,4-diamine |
| SMILES | O=[N+]([O-])c1ccc(Cn2cc(Nc3ncc(Cl)c(Nc4ccn[nH]4)n3)cn2)cc1 |
| InChI | InChI=1S/C17H14ClN9O2/c18-14-8-19-17(24-16(14)23-15-5-6-20-25-15)22-12-7-21-26(10-12)9-11-1-3-13(4-2-11)27(28)29/h1-8,10H,9H2,(H3,19,20,22,23,24,25) |
| InChIKey | WSICUNLBDQBVFB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 139.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.81 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|