C22H22ClN9O4 — CID 170699321
tert-butyl 3-[[5-chloro-2-[[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]amino]pyrimidin-4-yl]amino]pyrazole-1-carboxylate (PubChem CID 170699321) has the molecular formula C22H22ClN9O4 and a molecular weight of 511.93 g/mol. Its IUPAC name is tert-butyl 3-[[5-chloro-2-[[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]amino]pyrimidin-4-yl]amino]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-[[5-chloro-2-[[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]amino]pyrimidin-4-yl]amino]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 170699321 |
| Molecular Formula | C22H22ClN9O4 |
| Molecular Weight | 511.93 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | tert-butyl 3-[[5-chloro-2-[[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]amino]pyrimidin-4-yl]amino]pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1ccc(Nc2nc(Nc3cnn(Cc4ccc([N+](=O)[O-])cc4)c3)ncc2Cl)n1 |
| InChI | InChI=1S/C22H22ClN9O4/c1-22(2,3)36-21(33)31-9-8-18(29-31)27-19-17(23)11-24-20(28-19)26-15-10-25-30(13-15)12-14-4-6-16(7-5-14)32(34)35/h4-11,13H,12H2,1-3H3,(H2,24,26,27,28,29) |
| InChIKey | MLZIAHNKBCXGRL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.93 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|