C22H21ClN8O2 — CID 170699340
5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]pyrimidin-2-amine (PubChem CID 170699340) has the molecular formula C22H21ClN8O2 and a molecular weight of 464.92 g/mol. Its IUPAC name is 5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]pyrimidin-2-amine.
| Compound Name | 5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170699340 |
| Molecular Formula | C22H21ClN8O2 |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 5-chloro-4-[5-(cyclopropylmethyl)-1-methylpyrazol-4-yl]-N-[1-[(4-nitrophenyl)methyl]pyrazol-4-yl]pyrimidin-2-amine |
| SMILES | Cn1ncc(-c2nc(Nc3cnn(Cc4ccc([N+](=O)[O-])cc4)c3)ncc2Cl)c1CC1CC1 |
| InChI | InChI=1S/C22H21ClN8O2/c1-29-20(8-14-2-3-14)18(10-25-29)21-19(23)11-24-22(28-21)27-16-9-26-30(13-16)12-15-4-6-17(7-5-15)31(32)33/h4-7,9-11,13-14H,2-3,8,12H2,1H3,(H,24,27,28) |
| InChIKey | CQBSMHNAUVQDNB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|