C27H42N10O5S — CID 170721592
2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid (PubChem CID 170721592) has the molecular formula C27H42N10O5S and a molecular weight of 618.77 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 170721592 |
| Molecular Formula | C27H42N10O5S |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(2-sulfanylidene-1,3-dihydroimidazol-4-yl)propanoyl]amino]hexanoyl]amino]-3-phenylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1c[nH]c(=S)[nH]1)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C27H42N10O5S/c28-11-5-4-10-19(23(39)37-21(25(41)42)13-16-7-2-1-3-8-16)35-24(40)20(14-17-15-33-27(43)34-17)36-22(38)18(29)9-6-12-32-26(30)31/h1-3,7-8,15,18-21H,4-6,9-14,28-29H2,(H,35,40)(H,36,38)(H,37,39)(H,41,42)(H4,30,31,32)(H2,33,34,43) |
| InChIKey | LSKVBZRVNKHWRN-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 272.62 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|