About CID 170722364
CID 170722364 (PubChem CID 170722364) has the molecular formula C49H30B5N3O
and a molecular weight of 730.86 g/mol.
Molecular Properties
| Compound Name | CID 170722364 |
| PubChem CID | 170722364 |
| Molecular Formula | C49H30B5N3O |
| Molecular Weight | 730.86 g/mol |
| Exact Mass | 731.29 |
| IUPAC Name | — |
| SMILES | [B]c1c([B])c([B])c(-c2nc(-c3ccc4c5c(oc4c3)C=CCC5)nc(C34CCC(c5c(-c6ccccc6)cccc53)c3c(-c5ccccc5)cccc34)n2)c([B])c1[B] |
| InChI | InChI=1S/C49H30B5N3O/c50-41-40(42(51)44(53)45(54)43(41)52)47-55-46(28-21-22-32-31-15-7-8-20-36(31)58-37(32)25-28)56-48(57-47)49-24-23-33(38-29(16-9-18-34(38)49)26-11-3-1-4-12-26)39-30(17-10-19-35(39)49)27-13-5-2-6-14-27/h1-6,8-14,16-22,25,33H,7,15,23-24H2 |
| InChIKey | JVZXENVLHVVWGE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 730.86 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170722364 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170722364?
The IUPAC name of CID 170722364 (CID 170722364) is not available.
What is the SMILES notation for CID 170722364?
The canonical SMILES for CID 170722364 is [B]c1c([B])c([B])c(-c2nc(-c3ccc4c5c(oc4c3)C=CCC5)nc(C34CCC(c5c(-c6ccccc6)cccc53)c3c(-c5ccccc5)cccc34)n2)c([B])c1[B].
What is the InChIKey of CID 170722364?
The InChIKey is JVZXENVLHVVWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H30B5N3O/c50-41-40(42(51)44(53)45(54)43(41)52)47-55-46(28-21-22-32-31-15-7-8-20-36(31)58-37(32)25-28)56-48(57-47)49-24-23-33(38-29(16-9-18-34(38)49)26-11-3-1-4-12-26)39-30(17-10-19-35(39)49)27-13-5-2-6-14-27/h1-6,8-14,16-22,25,33H,7,15,23-24H2.
What are the key properties of CID 170722364?
CID 170722364 has a molecular weight of 730.86 g/mol, XLogP of 5.79, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170722364 is sourced from PubChem (CID 170722364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).