C13H8ClN3OS — CID 170725745
3-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide (PubChem CID 170725745) has the molecular formula C13H8ClN3OS and a molecular weight of 289.75 g/mol. Its IUPAC name is 3-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide.
| Compound Name | 3-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide |
|---|---|
| PubChem CID | 170725745 |
| Molecular Formula | C13H8ClN3OS |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 3-(6-chloro-[1,3]thiazolo[5,4-c]pyridin-2-yl)benzamide |
| SMILES | NC(=O)c1cccc(-c2nc3cc(Cl)ncc3s2)c1 |
| InChI | InChI=1S/C13H8ClN3OS/c14-11-5-9-10(6-16-11)19-13(17-9)8-3-1-2-7(4-8)12(15)18/h1-6H,(H2,15,18) |
| InChIKey | ITXJEXTYOJPNAW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|