C14H30N2 — CID 170732032
ethane;(E)-2-ethenyl-N-ethyl-N',3,4-trimethylpent-2-enimidamide;molecular hydrogen (PubChem CID 170732032) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is ethane;(E)-2-ethenyl-N-ethyl-N',3,4-trimethylpent-2-enimidamide;molecular hydrogen.
| Compound Name | ethane;(E)-2-ethenyl-N-ethyl-N',3,4-trimethylpent-2-enimidamide;molecular hydrogen |
|---|---|
| PubChem CID | 170732032 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | ethane;(E)-2-ethenyl-N-ethyl-N',3,4-trimethylpent-2-enimidamide;molecular hydrogen |
| SMILES | C=CC(/C(=N/C)NCC)=C(/C)C(C)C.CC.[H][H] |
| InChI | InChI=1S/C12H22N2.C2H6.H2/c1-7-11(10(5)9(3)4)12(13-6)14-8-2;1-2;/h7,9H,1,8H2,2-6H3,(H,13,14);1-2H3;1H/b11-10+;; |
| InChIKey | WORCPTYQLOUOGH-BGNBUWATSA-N |
| XLogP | 4.05 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|