C12H26O6 — CID 170743133
8-methoxy-8-propoxyoctane-1,4,5,7-tetrol (PubChem CID 170743133) has the molecular formula C12H26O6 and a molecular weight of 266.33 g/mol. Its IUPAC name is 8-methoxy-8-propoxyoctane-1,4,5,7-tetrol.
| Compound Name | 8-methoxy-8-propoxyoctane-1,4,5,7-tetrol |
|---|---|
| PubChem CID | 170743133 |
| Molecular Formula | C12H26O6 |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 8-methoxy-8-propoxyoctane-1,4,5,7-tetrol |
| SMILES | CCCOC(OC)C(O)CC(O)C(O)CCCO |
| InChI | InChI=1S/C12H26O6/c1-3-7-18-12(17-2)11(16)8-10(15)9(14)5-4-6-13/h9-16H,3-8H2,1-2H3 |
| InChIKey | IVOPYFCQNWRLIU-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|