C24H28ClF3N4O7S — CID 170764873
tert-butyl 4-[2-(4-chlorophenyl)-2-[[3-nitro-4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]piperazine-1-carboxylate (PubChem CID 170764873) has the molecular formula C24H28ClF3N4O7S and a molecular weight of 609.02 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-chlorophenyl)-2-[[3-nitro-4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(4-chlorophenyl)-2-[[3-nitro-4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170764873 |
| Molecular Formula | C24H28ClF3N4O7S |
| Molecular Weight | 609.02 g/mol |
| Exact Mass | 608.13 |
| IUPAC Name | tert-butyl 4-[2-(4-chlorophenyl)-2-[[3-nitro-4-(trifluoromethoxy)phenyl]sulfonylamino]ethyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC(NS(=O)(=O)c2ccc(OC(F)(F)F)c([N+](=O)[O-])c2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H28ClF3N4O7S/c1-23(2,3)39-22(33)31-12-10-30(11-13-31)15-19(16-4-6-17(25)7-5-16)29-40(36,37)18-8-9-21(38-24(26,27)28)20(14-18)32(34)35/h4-9,14,19,29H,10-13,15H2,1-3H3 |
| InChIKey | VPRVWEKSDVGDSE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.02 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|