C15H20F3NO3S — CID 170769878
2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methylphenyl)butyl]sulfanylbutanoic acid (PubChem CID 170769878) has the molecular formula C15H20F3NO3S and a molecular weight of 351.39 g/mol. Its IUPAC name is 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methylphenyl)butyl]sulfanylbutanoic acid.
| Compound Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methylphenyl)butyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 170769878 |
| Molecular Formula | C15H20F3NO3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-amino-4-[4,4,4-trifluoro-3-hydroxy-3-(4-methylphenyl)butyl]sulfanylbutanoic acid |
| SMILES | Cc1ccc(C(O)(CCSCCC(N)C(=O)O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NO3S/c1-10-2-4-11(5-3-10)14(22,15(16,17)18)7-9-23-8-6-12(19)13(20)21/h2-5,12,22H,6-9,19H2,1H3,(H,20,21) |
| InChIKey | QMUNMKCBDFPBTI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|