C16H21N3O2 — CID 170790225
2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(2-methoxyprop-2-enyl)-5-(methylamino)pyrimidin-4-one (PubChem CID 170790225) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(2-methoxyprop-2-enyl)-5-(methylamino)pyrimidin-4-one.
| Compound Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(2-methoxyprop-2-enyl)-5-(methylamino)pyrimidin-4-one |
|---|---|
| PubChem CID | 170790225 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-(2-methoxyprop-2-enyl)-5-(methylamino)pyrimidin-4-one |
| SMILES | C=C/C(=C\C=C/C)c1ncc(NC)c(=O)n1CC(=C)OC |
| InChI | InChI=1S/C16H21N3O2/c1-6-8-9-13(7-2)15-18-10-14(17-4)16(20)19(15)11-12(3)21-5/h6-10,17H,2-3,11H2,1,4-5H3/b8-6-,13-9+ |
| InChIKey | OYHGYGLHJFUOIY-NGRYOTTMSA-N |
| XLogP | 2.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|