C17H28BN3O4S — CID 170807149
tert-butyl N-[5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-2-yl]carbamate (PubChem CID 170807149) has the molecular formula C17H28BN3O4S and a molecular weight of 381.31 g/mol. Its IUPAC name is tert-butyl N-[5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-2-yl]carbamate |
|---|---|
| PubChem CID | 170807149 |
| Molecular Formula | C17H28BN3O4S |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | tert-butyl N-[5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-1,3-thiazol-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(C=C(CN)B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C17H28BN3O4S/c1-15(2,3)23-14(22)21-13-20-10-12(26-13)8-11(9-19)18-24-16(4,5)17(6,7)25-18/h8,10H,9,19H2,1-7H3,(H,20,21,22) |
| InChIKey | TVZBLXBOGVCPOB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|