C25H34BN3O6S — CID 170813665
benzyl N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170813665) has the molecular formula C25H34BN3O6S and a molecular weight of 515.44 g/mol. Its IUPAC name is benzyl N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | benzyl N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170813665 |
| Molecular Formula | C25H34BN3O6S |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | benzyl N-[3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1,3-thiazol-5-yl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ncc(C=C(CNC(=O)OCc2ccccc2)B2OC(C)(C)C(C)(C)O2)s1 |
| InChI | InChI=1S/C25H34BN3O6S/c1-23(2,3)33-22(31)29-20-27-15-19(36-20)13-18(26-34-24(4,5)25(6,7)35-26)14-28-21(30)32-16-17-11-9-8-10-12-17/h8-13,15H,14,16H2,1-7H3,(H,28,30)(H,27,29,31) |
| InChIKey | BGHPUBFLUWFDGD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|