C17H18FNO5 — CID 170829206
[4-(3-amino-1,2-dihydroxypropyl)-2-methoxyphenyl] 4-fluorobenzoate (PubChem CID 170829206) has the molecular formula C17H18FNO5 and a molecular weight of 335.33 g/mol. Its IUPAC name is [4-(3-amino-1,2-dihydroxypropyl)-2-methoxyphenyl] 4-fluorobenzoate.
| Compound Name | [4-(3-amino-1,2-dihydroxypropyl)-2-methoxyphenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 170829206 |
| Molecular Formula | C17H18FNO5 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | [4-(3-amino-1,2-dihydroxypropyl)-2-methoxyphenyl] 4-fluorobenzoate |
| SMILES | COc1cc(C(O)C(O)CN)ccc1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H18FNO5/c1-23-15-8-11(16(21)13(20)9-19)4-7-14(15)24-17(22)10-2-5-12(18)6-3-10/h2-8,13,16,20-21H,9,19H2,1H3 |
| InChIKey | IGNQIUAGSNGXAL-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|